Molecular Definition

Canonical SMILES CCCC\C=C\COC(=O)C1=C(C)NC(=O)NC1c2ccc(cc2)[N+](=O)[O-]
Formula C19H23N3O5
Molecular Weight 373.40 da
Stereocenters 0/1