Molecular Definition

Canonical SMILES CCC(=C)C(=O)c1ccc(OCC(=O)NCCCCCC(=O)NCc2cc(CNC(=O)CCCCCNC(=O)COc3ccc(C(=O)C(=C)C)c(Cl)c3Cl)cc(c2)C(=O)N)c(Cl)c1Cl
Formula C46H53Cl4N5O9
Molecular Weight 961.75 da
Stereocenters 0/0