Target Relevance

Molecular Definition

Canonical SMILES Cc1cccc(n1)c2nc(NCc3ccc(cc3)C(=O)N)sc2c4ccc5ncnn5c4
Formula C23H19N7OS
Molecular Weight 441.51 da
Stereocenters 0/0