Molecular Definition

Canonical SMILES Cc1c(F)cc(cc1c2c(F)cn3c(nnc3c2F)C(C)(C)N)C(=O)NC4CC4
Formula C20H20F3N5O
Molecular Weight 403.40 da
Stereocenters 0/0