Molecular Definition

Canonical SMILES Cc1c(F)cc(cc1c2c(F)cn3c(nnc3c2F)C4CC4)C(=O)NC5CC5
Formula C20H17F3N4O
Molecular Weight 386.37 da
Stereocenters 0/0