Molecular Definition

Canonical SMILES COC(C)(C)c1nnc2cc(ccn12)c3cc(cc(F)c3C)C(=O)NC4CC4
Formula C21H23FN4O2
Molecular Weight 382.43 da
Stereocenters 0/0