Molecular Definition

Canonical SMILES Cc1ccc(cc1c2ccn3c(nnc3c2)c4ccccc4Cl)C(=O)NC5CC5
Formula C23H19ClN4O
Molecular Weight 402.88 da
Stereocenters 0/0