Molecular Definition

Canonical SMILES Cc1ccc(cc1c2ccn3c(nnc3c2)C4(C)CC4)C(=O)NC5CC5
Formula C21H22N4O
Molecular Weight 346.43 da
Stereocenters 0/0