Molecular Definition

Canonical SMILES Cc1ccc(cc1c2ccn3c(nnc3c2)C4CC4)C(=O)NC5CC5
Formula C20H20N4O
Molecular Weight 332.40 da
Stereocenters 0/0