Molecular Definition

Canonical SMILES CCN1N=C(N=C2C(=O)N(C)C(=O)N=C12)c3ccc(OC)cc3
Formula C15H15N5O3
Molecular Weight 313.31 da
Stereocenters 0/0