Molecular Definition

Canonical SMILES CCN1CCC(CC1)Nc2ccc3NC(=O)C(=C(c4cccc(F)c4)c5ncc[nH]5)c3c2
Formula C25H26FN5O
Molecular Weight 431.51 da
Stereocenters 0/0