Molecular Definition

Canonical SMILES CC1=C(C(NC(=O)N1)c2ccc(Cl)cc2)C(=O)OC3CCCC3
Formula C17H19ClN2O3
Molecular Weight 334.80 da
Stereocenters 0/1