Molecular Definition

Canonical SMILES Cc1ccc(cc1)S(=O)(=O)N2CCCC[C@@H]2C(=O)Nc3nc(cs3)c4ccc5occc5c4
Formula C24H23N3O4S2
Molecular Weight 481.59 da
Stereocenters 1/1