Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3C(=O)c4ccccc4)n2
Formula C23H23N3O3S
Molecular Weight 421.51 da
Stereocenters 1/1