Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c4cccnc4)n2
Formula C21H22N4O4S2
Molecular Weight 458.55 da
Stereocenters 1/1