Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c4cccc(F)c4)n2
Formula C22H22FN3O4S2
Molecular Weight 475.56 da
Stereocenters 1/1