Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c4cccc(c4)C(F)(F)F)n2
Formula C23H22F3N3O4S2
Molecular Weight 525.56 da
Stereocenters 1/1