Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c4ccc(cc4)C(C)C)n2
Formula C25H29N3O4S2
Molecular Weight 499.65 da
Stereocenters 1/1