Molecular Definition

Canonical SMILES COc1ccc(cc1)c2csc(NC(=O)[C@H]3CCCCN3S(=O)(=O)c4ccccc4C)n2
Formula C23H25N3O4S2
Molecular Weight 471.59 da
Stereocenters 1/1