Molecular Definition

Canonical SMILES CCC1Oc2c(C)c(O)ccc2c3ccc(O)c(C)c13
Formula C17H18O3
Molecular Weight 270.32 da
Stereocenters 0/1