Target Relevance

Molecular Definition

Canonical SMILES COC(=O)c1ccc(cc1)c2cc(ccn2)c3c[nH]nc3c4ccccn4
Formula C21H16N4O2
Molecular Weight 356.38 da
Stereocenters 0/0