Molecular Definition

Canonical SMILES CC[C@@](C)(Cc1ccc(OCCCOc2ccc(Oc3ccc(F)cc3)cc2Cl)cc1)C(=O)O
Formula C27H28ClFO5
Molecular Weight 486.96 da
Stereocenters 1/1