Molecular Definition

Canonical SMILES CN1CCN(CC1)C(=O)c2cc(Nc3ncc4cc(c5ocnc5)n(C6CCCC6)c4n3)cn2C
Formula C25H30N8O2
Molecular Weight 474.56 da
Stereocenters 0/0