Molecular Definition

Canonical SMILES CC[C@@H]([C@@H]1CCc2cc(OCCc3nc(oc3C)c4ccc(F)cc4)ccc12)C(=O)O
Formula C25H26FNO4
Molecular Weight 423.48 da
Stereocenters 2/2