Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1ccc(NC2=C\C(=N\S(=O)(=O)c3ccccc3)\c4ccccc4C2=O)cc1
Formula C23H16N2O5S
Molecular Weight 432.45 da
Stereocenters 0/0