Target Relevance

Molecular Definition

Canonical SMILES CN(C)CC\N=C\1/C=C(O)c2oc(nc2C1=O)c3ccccc3
Formula C17H17N3O3
Molecular Weight 311.34 da
Stereocenters 0/0