Target Relevance

Molecular Definition

Canonical SMILES CCc1oc2C(=C\C(=N/CCN(C)C)\C(=O)c2n1)O
Formula C13H17N3O3
Molecular Weight 263.29 da
Stereocenters 0/0