Molecular Definition

Canonical SMILES FC(F)(CNc1nccc2oc(Cc3ccccc3n4cncn4)nc12)C5CCCCN5
Formula C22H23F2N7O
Molecular Weight 439.46 da
Stereocenters 0/1