Molecular Definition

Canonical SMILES OB(O)[C@@H]1CCCN1C(=O)CNC2CCCCCC2
Formula C13H25BN2O3
Molecular Weight 268.16 da
Stereocenters 1/1