Target Relevance

Molecular Definition

Canonical SMILES Cc1ccc(c(C)c1)S(=O)(=O)\N=C\2/C=C(Nc3cccc(c3)C(=O)O)C(=O)c4ccccc24
Formula C25H20N2O5S
Molecular Weight 460.50 da
Stereocenters 0/0