Molecular Definition

Canonical SMILES OB(O)[C@@H]1CCCN1C(=O)CNC2CCCCCCCCC2
Formula C16H31BN2O3
Molecular Weight 310.24 da
Stereocenters 1/1