Molecular Definition

Canonical SMILES COc1cc2CCN(C(=O)Cc3cccc(Cl)c3F)c2cc1N4C[C@@H](C)N(C)[C@@H](C)C4
Formula C24H29ClFN3O2
Molecular Weight 445.96 da
Stereocenters 2/2