Target Relevance

Molecular Definition

Canonical SMILES CC1=CC(=O)Oc2cc(NC(=O)OC(C)(C)C)ccc12
Formula C15H17NO4
Molecular Weight 275.30 da
Stereocenters 0/0