Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)[Si](C)(C)Oc1ccc2C=CC(=S)Oc2c1
Formula C15H20O2SSi
Molecular Weight 292.47 da
Stereocenters 0/0