Molecular Definition

Canonical SMILES COc1cc2CCN(C(=O)c3ccc(c4cccc(C)n4)c5ccccc35)c2cc1N6C[C@@H](C)N(C)[C@@H](C)C6
Formula C33H36N4O2
Molecular Weight 520.66 da
Stereocenters 2/2