Molecular Definition

Canonical SMILES O[C@@H]1[C@@H](CNCCOc2ccccc2)CCC1(c3ccccc3)c4ccccc4.OC(=O)C(=O)O
Formula C28H31NO6
Molecular Weight 477.55 da
Stereocenters 2/2