Target Relevance

Molecular Definition

Canonical SMILES Oc1ccc(CCNCCc2ccc(CNCCc3ccccn3)cc2)c4SC(=O)Nc14
Formula C25H28N4O2S
Molecular Weight 448.58 da
Stereocenters 0/0