Molecular Definition

Canonical SMILES COc1cccc(CNCc2cccc(CCNC[C@H](O)c3ccc(O)c4NC(=O)Sc34)c2)c1
Formula C26H29N3O4S
Molecular Weight 479.59 da
Stereocenters 1/1