Molecular Definition

Canonical SMILES CCCC[C@H](N)C(=O)N[C@H](CCCC)B(O)O
Formula C11H25BN2O3
Molecular Weight 244.14 da
Stereocenters 2/2