Target Relevance

Molecular Definition

Canonical SMILES CC(C)c1cccc2sc(cc12)C(=O)N=C(N)N.CS(=O)(=O)O
Formula C14H19N3O4S2
Molecular Weight 357.45 da
Stereocenters 0/0