Molecular Definition

Canonical SMILES Cc1c(O)ccc2c(cccc12)c3c(Cl)cc(NC(=O)O)cc3Cl
Formula C18H13Cl2NO3
Molecular Weight 362.21 da
Stereocenters 0/0