Target Relevance

Molecular Definition

Canonical SMILES CS(=O)(=O)c1ccc(cc1)c2ccc3cnc(Nc4ccc(cc4)C5CCN(CC(=O)N)CC5)nn23
Formula C26H28N6O3S
Molecular Weight 504.60 da
Stereocenters 0/0