Target Relevance

Molecular Definition

Canonical SMILES NC(=N)NC(=O)c1oc(cc1)c2cc(Cl)cc(Cl)c2
Formula C12H9Cl2N3O2
Molecular Weight 298.13 da
Stereocenters 0/0