Molecular Definition

Canonical SMILES CCCc1cc2N(CC(F)(F)F)C(=O)Oc2c(CCC)c1O[C@H](C(=O)O)c3ccc(cc3)C(C)C
Formula C26H30F3NO5
Molecular Weight 493.52 da
Stereocenters 1/1