Target Relevance

Molecular Definition

Canonical SMILES CC(C)Oc1nc(Nc2ccc3[nH]cnc3c2)ncc1C(F)(F)F
Formula C15H14F3N5O
Molecular Weight 337.30 da
Stereocenters 0/0