Molecular Definition

Canonical SMILES CC(C)OC(=O)c1ccc2c(c1)c3ccccc3n2CCCN4C[C@@H](C)N[C@@H](C)C4
Formula C25H33N3O2
Molecular Weight 407.55 da
Stereocenters 2/2