Molecular Definition

Canonical SMILES COC(=O)c1ccc2c(c1)c3ccccc3n2CCCN4C[C@@H](C)N[C@@H](C)C4
Formula C23H29N3O2
Molecular Weight 379.50 da
Stereocenters 2/2