Molecular Definition

Canonical SMILES COC(=O)\C=C\C(=O)NC[C@H](N)C(=O)O
Formula C8H12N2O5
Molecular Weight 216.19 da
Stereocenters 1/1