Molecular Definition

Canonical SMILES COc1cc2c(CNS(=O)(=O)C(F)(F)F)cnc(C(=O)c3cccc(OC(C)C)c3)c2cc1OC
Formula C23H23F3N2O6S
Molecular Weight 512.50 da
Stereocenters 0/0