Molecular Definition

Canonical SMILES COc1ccc(cc1C(=O)O)S(=O)(=O)NC(=O)c2sccc2SCc3ccc(Cl)c(Cl)c3
Formula C20H15Cl2NO6S3
Molecular Weight 532.44 da
Stereocenters 0/0